C11H11NO3 — CID 145123854
5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,2-oxazole-3-carboxylic acid (PubChem CID 145123854) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 145123854 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,2-oxazole-3-carboxylic acid |
| SMILES | C=C/C=C(\C=C/C)c1cc(C(=O)O)no1 |
| InChI | InChI=1S/C11H11NO3/c1-3-5-8(6-4-2)10-7-9(11(13)14)12-15-10/h3-7H,1H2,2H3,(H,13,14)/b6-4-,8-5+ |
| InChIKey | ASULWKUZGBOTAD-QXMOYCCXSA-N |
| XLogP | 2.52 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|