C7H9NO3 — CID 161083029
1,2-oxazole-3-carboxylic acid;prop-1-ene (PubChem CID 161083029) has the molecular formula C7H9NO3 and a molecular weight of 155.15 g/mol. Its IUPAC name is 1,2-oxazole-3-carboxylic acid;prop-1-ene.
| Compound Name | 1,2-oxazole-3-carboxylic acid;prop-1-ene |
|---|---|
| PubChem CID | 161083029 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | 1,2-oxazole-3-carboxylic acid;prop-1-ene |
| SMILES | C=CC.O=C(O)c1ccon1 |
| InChI | InChI=1S/C4H3NO3.C3H6/c6-4(7)3-1-2-8-5-3;1-3-2/h1-2H,(H,6,7);3H,1H2,2H3 |
| InChIKey | UGDPSPKRXXDOJW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|