C10H15NO2 — CID 143157807
ethane;3-[(Z)-1-ethenoxyprop-1-enyl]-1,2-oxazole (PubChem CID 143157807) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is ethane;3-[(Z)-1-ethenoxyprop-1-enyl]-1,2-oxazole.
| Compound Name | ethane;3-[(Z)-1-ethenoxyprop-1-enyl]-1,2-oxazole |
|---|---|
| PubChem CID | 143157807 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | ethane;3-[(Z)-1-ethenoxyprop-1-enyl]-1,2-oxazole |
| SMILES | C=CO/C(=C\C)c1ccon1.CC |
| InChI | InChI=1S/C8H9NO2.C2H6/c1-3-8(10-4-2)7-5-6-11-9-7;1-2/h3-6H,2H2,1H3;1-2H3/b8-3-; |
| InChIKey | OYOPIUBOFUIUMD-NGRDVXTNSA-N |
| XLogP | 3.22 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|