About ethane;3-[(Z)-1-ethenoxyprop-1-enyl]-1,2-oxazole
ethane;3-[(Z)-1-ethenoxyprop-1-enyl]-1,2-oxazole (PubChem CID 143157807) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is ethane;3-[(Z)-1-ethenoxyprop-1-enyl]-1,2-oxazole.
Molecular Properties
| Compound Name | ethane;3-[(Z)-1-ethenoxyprop-1-enyl]-1,2-oxazole |
| PubChem CID | 143157807 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | ethane;3-[(Z)-1-ethenoxyprop-1-enyl]-1,2-oxazole |
| SMILES | C=CO/C(=C\C)c1ccon1.CC |
| InChI | InChI=1S/C8H9NO2.C2H6/c1-3-8(10-4-2)7-5-6-11-9-7;1-2/h3-6H,2H2,1H3;1-2H3/b8-3-; |
| InChIKey | OYOPIUBOFUIUMD-NGRDVXTNSA-N |
| XLogP | 3.22 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-[(Z)-1-ethenoxyprop-1-enyl]-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-[(Z)-1-ethenoxyprop-1-enyl]-1,2-oxazole?
The IUPAC name of ethane;3-[(Z)-1-ethenoxyprop-1-enyl]-1,2-oxazole (CID 143157807) is ethane;3-[(Z)-1-ethenoxyprop-1-enyl]-1,2-oxazole.
What is the SMILES notation for ethane;3-[(Z)-1-ethenoxyprop-1-enyl]-1,2-oxazole?
The canonical SMILES for ethane;3-[(Z)-1-ethenoxyprop-1-enyl]-1,2-oxazole is C=CO/C(=C\C)c1ccon1.CC.
What is the InChIKey of ethane;3-[(Z)-1-ethenoxyprop-1-enyl]-1,2-oxazole?
The InChIKey is OYOPIUBOFUIUMD-NGRDVXTNSA-N. The full InChI is InChI=1S/C8H9NO2.C2H6/c1-3-8(10-4-2)7-5-6-11-9-7;1-2/h3-6H,2H2,1H3;1-2H3/b8-3-;.
What are the key properties of ethane;3-[(Z)-1-ethenoxyprop-1-enyl]-1,2-oxazole?
ethane;3-[(Z)-1-ethenoxyprop-1-enyl]-1,2-oxazole has a molecular weight of 181.23 g/mol, XLogP of 3.22, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-[(Z)-1-ethenoxyprop-1-enyl]-1,2-oxazole is sourced from PubChem (CID 143157807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).