About 3-non-1-en-2-yl-1,2-oxazole
3-non-1-en-2-yl-1,2-oxazole (PubChem CID 175339452) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 3-non-1-en-2-yl-1,2-oxazole.
Molecular Properties
| Compound Name | 3-non-1-en-2-yl-1,2-oxazole |
| PubChem CID | 175339452 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 3-non-1-en-2-yl-1,2-oxazole |
| SMILES | C=C(CCCCCCC)c1ccon1 |
| InChI | InChI=1S/C12H19NO/c1-3-4-5-6-7-8-11(2)12-9-10-14-13-12/h9-10H,2-8H2,1H3 |
| InChIKey | FMNXOEYSYONBTP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-non-1-en-2-yl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-non-1-en-2-yl-1,2-oxazole?
The IUPAC name of 3-non-1-en-2-yl-1,2-oxazole (CID 175339452) is 3-non-1-en-2-yl-1,2-oxazole.
What is the SMILES notation for 3-non-1-en-2-yl-1,2-oxazole?
The canonical SMILES for 3-non-1-en-2-yl-1,2-oxazole is C=C(CCCCCCC)c1ccon1.
What is the InChIKey of 3-non-1-en-2-yl-1,2-oxazole?
The InChIKey is FMNXOEYSYONBTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-3-4-5-6-7-8-11(2)12-9-10-14-13-12/h9-10H,2-8H2,1H3.
What are the key properties of 3-non-1-en-2-yl-1,2-oxazole?
3-non-1-en-2-yl-1,2-oxazole has a molecular weight of 193.29 g/mol, XLogP of 4.05, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-non-1-en-2-yl-1,2-oxazole is sourced from PubChem (CID 175339452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).