About 2-hept-1-en-2-ylpyridine
2-hept-1-en-2-ylpyridine (PubChem CID 67857415) has the molecular formula C12H17N
and a molecular weight of 175.28 g/mol. Its IUPAC name is 2-hept-1-en-2-ylpyridine.
Molecular Properties
| Compound Name | 2-hept-1-en-2-ylpyridine |
| PubChem CID | 67857415 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 2-hept-1-en-2-ylpyridine |
| SMILES | C=C(CCCCC)c1ccccn1 |
| InChI | InChI=1S/C12H17N/c1-3-4-5-8-11(2)12-9-6-7-10-13-12/h6-7,9-10H,2-5,8H2,1H3 |
| InChIKey | UTPVCAPWKNUCRI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hept-1-en-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hept-1-en-2-ylpyridine?
The IUPAC name of 2-hept-1-en-2-ylpyridine (CID 67857415) is 2-hept-1-en-2-ylpyridine.
What is the SMILES notation for 2-hept-1-en-2-ylpyridine?
The canonical SMILES for 2-hept-1-en-2-ylpyridine is C=C(CCCCC)c1ccccn1.
What is the InChIKey of 2-hept-1-en-2-ylpyridine?
The InChIKey is UTPVCAPWKNUCRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c1-3-4-5-8-11(2)12-9-6-7-10-13-12/h6-7,9-10H,2-5,8H2,1H3.
What are the key properties of 2-hept-1-en-2-ylpyridine?
2-hept-1-en-2-ylpyridine has a molecular weight of 175.28 g/mol, XLogP of 3.68, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hept-1-en-2-ylpyridine is sourced from PubChem (CID 67857415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).