C11H15NO3S — CID 175534242
5-pyridin-2-ylhex-5-ene-1-sulfonic acid (PubChem CID 175534242) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is 5-pyridin-2-ylhex-5-ene-1-sulfonic acid.
| Compound Name | 5-pyridin-2-ylhex-5-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 175534242 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 5-pyridin-2-ylhex-5-ene-1-sulfonic acid |
| SMILES | C=C(CCCCS(=O)(=O)O)c1ccccn1 |
| InChI | InChI=1S/C11H15NO3S/c1-10(11-7-2-4-8-12-11)6-3-5-9-16(13,14)15/h2,4,7-8H,1,3,5-6,9H2,(H,13,14,15) |
| InChIKey | UIVMYQOZJVUMAD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|