C8H10N2O7S2 — CID 90695309
[pyridine-2-carbonyl(sulfomethyl)amino]methanesulfonic acid (PubChem CID 90695309) has the molecular formula C8H10N2O7S2 and a molecular weight of 310.31 g/mol. Its IUPAC name is [pyridine-2-carbonyl(sulfomethyl)amino]methanesulfonic acid.
| Compound Name | [pyridine-2-carbonyl(sulfomethyl)amino]methanesulfonic acid |
|---|---|
| PubChem CID | 90695309 |
| Molecular Formula | C8H10N2O7S2 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | [pyridine-2-carbonyl(sulfomethyl)amino]methanesulfonic acid |
| SMILES | O=C(c1ccccn1)N(CS(=O)(=O)O)CS(=O)(=O)O |
| InChI | InChI=1S/C8H10N2O7S2/c11-8(7-3-1-2-4-9-7)10(5-18(12,13)14)6-19(15,16)17/h1-4H,5-6H2,(H,12,13,14)(H,15,16,17) |
| InChIKey | DFLLCQDFZDTQIS-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 141.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|