About O-pentyl pyridine-2-carbothioate
O-pentyl pyridine-2-carbothioate (PubChem CID 88693727) has the molecular formula C11H15NOS
and a molecular weight of 209.31 g/mol. Its IUPAC name is O-pentyl pyridine-2-carbothioate.
Molecular Properties
| Compound Name | O-pentyl pyridine-2-carbothioate |
| PubChem CID | 88693727 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | O-pentyl pyridine-2-carbothioate |
| SMILES | CCCCCOC(=S)c1ccccn1 |
| InChI | InChI=1S/C11H15NOS/c1-2-3-6-9-13-11(14)10-7-4-5-8-12-10/h4-5,7-8H,2-3,6,9H2,1H3 |
| InChIKey | OKFBXFFBUIMPLQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-pentyl pyridine-2-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-pentyl pyridine-2-carbothioate?
The IUPAC name of O-pentyl pyridine-2-carbothioate (CID 88693727) is O-pentyl pyridine-2-carbothioate.
What is the SMILES notation for O-pentyl pyridine-2-carbothioate?
The canonical SMILES for O-pentyl pyridine-2-carbothioate is CCCCCOC(=S)c1ccccn1.
What is the InChIKey of O-pentyl pyridine-2-carbothioate?
The InChIKey is OKFBXFFBUIMPLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NOS/c1-2-3-6-9-13-11(14)10-7-4-5-8-12-10/h4-5,7-8H,2-3,6,9H2,1H3.
What are the key properties of O-pentyl pyridine-2-carbothioate?
O-pentyl pyridine-2-carbothioate has a molecular weight of 209.31 g/mol, XLogP of 2.96, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-pentyl pyridine-2-carbothioate is sourced from PubChem (CID 88693727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).