About methyl (E)-2-(1,2-oxazol-3-yl)but-2-enoate
methyl (E)-2-(1,2-oxazol-3-yl)but-2-enoate (PubChem CID 67912409) has the molecular formula C8H9NO3
and a molecular weight of 167.16 g/mol. Its IUPAC name is methyl (E)-2-(1,2-oxazol-3-yl)but-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-2-(1,2-oxazol-3-yl)but-2-enoate |
| PubChem CID | 67912409 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | methyl (E)-2-(1,2-oxazol-3-yl)but-2-enoate |
| SMILES | C/C=C(/C(=O)OC)c1ccon1 |
| InChI | InChI=1S/C8H9NO3/c1-3-6(8(10)11-2)7-4-5-12-9-7/h3-5H,1-2H3/b6-3+ |
| InChIKey | KGQJCUFTQYTEEY-ZZXKWVIFSA-N |
| XLogP | 1.25 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-2-(1,2-oxazol-3-yl)but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-2-(1,2-oxazol-3-yl)but-2-enoate?
The IUPAC name of methyl (E)-2-(1,2-oxazol-3-yl)but-2-enoate (CID 67912409) is methyl (E)-2-(1,2-oxazol-3-yl)but-2-enoate.
What is the SMILES notation for methyl (E)-2-(1,2-oxazol-3-yl)but-2-enoate?
The canonical SMILES for methyl (E)-2-(1,2-oxazol-3-yl)but-2-enoate is C/C=C(/C(=O)OC)c1ccon1.
What is the InChIKey of methyl (E)-2-(1,2-oxazol-3-yl)but-2-enoate?
The InChIKey is KGQJCUFTQYTEEY-ZZXKWVIFSA-N. The full InChI is InChI=1S/C8H9NO3/c1-3-6(8(10)11-2)7-4-5-12-9-7/h3-5H,1-2H3/b6-3+.
What are the key properties of methyl (E)-2-(1,2-oxazol-3-yl)but-2-enoate?
methyl (E)-2-(1,2-oxazol-3-yl)but-2-enoate has a molecular weight of 167.16 g/mol, XLogP of 1.25, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-2-(1,2-oxazol-3-yl)but-2-enoate is sourced from PubChem (CID 67912409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).