C7H5NO5 — CID 70426222
2-(1,2-oxazol-3-yl)but-2-enedioic acid (PubChem CID 70426222) has the molecular formula C7H5NO5 and a molecular weight of 183.12 g/mol. Its IUPAC name is 2-(1,2-oxazol-3-yl)but-2-enedioic acid.
| Compound Name | 2-(1,2-oxazol-3-yl)but-2-enedioic acid |
|---|---|
| PubChem CID | 70426222 |
| Molecular Formula | C7H5NO5 |
| Molecular Weight | 183.12 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | 2-(1,2-oxazol-3-yl)but-2-enedioic acid |
| SMILES | O=C(O)C=C(C(=O)O)c1ccon1 |
| InChI | InChI=1S/C7H5NO5/c9-6(10)3-4(7(11)12)5-1-2-13-8-5/h1-3H,(H,9,10)(H,11,12) |
| InChIKey | HAJABSLTFBMXSL-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.12 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|