About prop-2-enyl 2-(1,2-oxazol-3-yl)acetate
prop-2-enyl 2-(1,2-oxazol-3-yl)acetate (PubChem CID 70025625) has the molecular formula C8H9NO3
and a molecular weight of 167.16 g/mol. Its IUPAC name is prop-2-enyl 2-(1,2-oxazol-3-yl)acetate.
Molecular Properties
| Compound Name | prop-2-enyl 2-(1,2-oxazol-3-yl)acetate |
| PubChem CID | 70025625 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | prop-2-enyl 2-(1,2-oxazol-3-yl)acetate |
| SMILES | C=CCOC(=O)Cc1ccon1 |
| InChI | InChI=1S/C8H9NO3/c1-2-4-11-8(10)6-7-3-5-12-9-7/h2-3,5H,1,4,6H2 |
| InChIKey | NMNSGBYGNUMZNA-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 2-(1,2-oxazol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 2-(1,2-oxazol-3-yl)acetate?
The IUPAC name of prop-2-enyl 2-(1,2-oxazol-3-yl)acetate (CID 70025625) is prop-2-enyl 2-(1,2-oxazol-3-yl)acetate.
What is the SMILES notation for prop-2-enyl 2-(1,2-oxazol-3-yl)acetate?
The canonical SMILES for prop-2-enyl 2-(1,2-oxazol-3-yl)acetate is C=CCOC(=O)Cc1ccon1.
What is the InChIKey of prop-2-enyl 2-(1,2-oxazol-3-yl)acetate?
The InChIKey is NMNSGBYGNUMZNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3/c1-2-4-11-8(10)6-7-3-5-12-9-7/h2-3,5H,1,4,6H2.
What are the key properties of prop-2-enyl 2-(1,2-oxazol-3-yl)acetate?
prop-2-enyl 2-(1,2-oxazol-3-yl)acetate has a molecular weight of 167.16 g/mol, XLogP of 0.95, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 2-(1,2-oxazol-3-yl)acetate is sourced from PubChem (CID 70025625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).