C7H9NO3 — CID 45099106
ethyl 2-(1,2-oxazol-3-yl)acetate (PubChem CID 45099106) has the molecular formula C7H9NO3 and a molecular weight of 155.15 g/mol. Its IUPAC name is ethyl 2-(1,2-oxazol-3-yl)acetate.
| Compound Name | ethyl 2-(1,2-oxazol-3-yl)acetate |
|---|---|
| PubChem CID | 45099106 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | ethyl 2-(1,2-oxazol-3-yl)acetate |
| SMILES | CCOC(=O)Cc1ccon1 |
| InChI | InChI=1S/C7H9NO3/c1-2-10-7(9)5-6-3-4-11-8-6/h3-4H,2,5H2,1H3 |
| InChIKey | UBUOGYCODWVHOI-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |