About ethane;2-(1,2-oxazol-3-yl)acetic acid
ethane;2-(1,2-oxazol-3-yl)acetic acid (PubChem CID 91091562) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is ethane;2-(1,2-oxazol-3-yl)acetic acid.
Molecular Properties
| Compound Name | ethane;2-(1,2-oxazol-3-yl)acetic acid |
| PubChem CID | 91091562 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | ethane;2-(1,2-oxazol-3-yl)acetic acid |
| SMILES | CC.CC.O=C(O)Cc1ccon1 |
| InChI | InChI=1S/C5H5NO3.2C2H6/c7-5(8)3-4-1-2-9-6-4;2*1-2/h1-2H,3H2,(H,7,8);2*1-2H3 |
| InChIKey | QXVVOONPHKAMTB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-(1,2-oxazol-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(1,2-oxazol-3-yl)acetic acid?
The IUPAC name of ethane;2-(1,2-oxazol-3-yl)acetic acid (CID 91091562) is ethane;2-(1,2-oxazol-3-yl)acetic acid.
What is the SMILES notation for ethane;2-(1,2-oxazol-3-yl)acetic acid?
The canonical SMILES for ethane;2-(1,2-oxazol-3-yl)acetic acid is CC.CC.O=C(O)Cc1ccon1.
What is the InChIKey of ethane;2-(1,2-oxazol-3-yl)acetic acid?
The InChIKey is QXVVOONPHKAMTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO3.2C2H6/c7-5(8)3-4-1-2-9-6-4;2*1-2/h1-2H,3H2,(H,7,8);2*1-2H3.
What are the key properties of ethane;2-(1,2-oxazol-3-yl)acetic acid?
ethane;2-(1,2-oxazol-3-yl)acetic acid has a molecular weight of 187.24 g/mol, XLogP of 2.35, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(1,2-oxazol-3-yl)acetic acid is sourced from PubChem (CID 91091562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).