C12H22N2O3 — CID 160647596
N,N-diethylethanamine;ethyl 1,2-oxazole-3-carboxylate (PubChem CID 160647596) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is N,N-diethylethanamine;ethyl 1,2-oxazole-3-carboxylate.
| Compound Name | N,N-diethylethanamine;ethyl 1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 160647596 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | N,N-diethylethanamine;ethyl 1,2-oxazole-3-carboxylate |
| SMILES | CCN(CC)CC.CCOC(=O)c1ccon1 |
| InChI | InChI=1S/C6H7NO3.C6H15N/c1-2-9-6(8)5-3-4-10-7-5;1-4-7(5-2)6-3/h3-4H,2H2,1H3;4-6H2,1-3H3 |
| InChIKey | RJZKNWATDUGNHU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |