About ethane;ethyl 6-methylimidazo[1,2-b]pyridazine-2-carboxylate
ethane;ethyl 6-methylimidazo[1,2-b]pyridazine-2-carboxylate (PubChem CID 171811452) has the molecular formula C12H17N3O2
and a molecular weight of 235.29 g/mol. Its IUPAC name is ethane;ethyl 6-methylimidazo[1,2-b]pyridazine-2-carboxylate.
Analyze ethane;ethyl 6-methylimidazo[1,2-b]pyridazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethyl 6-methylimidazo[1,2-b]pyridazine-2-carboxylate?
The IUPAC name of ethane;ethyl 6-methylimidazo[1,2-b]pyridazine-2-carboxylate (CID 171811452) is ethane;ethyl 6-methylimidazo[1,2-b]pyridazine-2-carboxylate.
What is the SMILES notation for ethane;ethyl 6-methylimidazo[1,2-b]pyridazine-2-carboxylate?
The canonical SMILES for ethane;ethyl 6-methylimidazo[1,2-b]pyridazine-2-carboxylate is CC.CCOC(=O)c1cn2nc(C)ccc2n1.
What is the InChIKey of ethane;ethyl 6-methylimidazo[1,2-b]pyridazine-2-carboxylate?
The InChIKey is KHZPETQJCCPMQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O2.C2H6/c1-3-15-10(14)8-6-13-9(11-8)5-4-7(2)12-13;1-2/h4-6H,3H2,1-2H3;1-2H3.
What are the key properties of ethane;ethyl 6-methylimidazo[1,2-b]pyridazine-2-carboxylate?
ethane;ethyl 6-methylimidazo[1,2-b]pyridazine-2-carboxylate has a molecular weight of 235.29 g/mol, XLogP of 2.24, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl 6-methylimidazo[1,2-b]pyridazine-2-carboxylate is sourced from PubChem (CID 171811452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).