C16H17BrN2O6 — CID 159035617
ethyl 3-bromo-2-oxopropanoate;ethyl 6-formylimidazo[1,2-a]pyridine-2-carboxylate (PubChem CID 159035617) has the molecular formula C16H17BrN2O6 and a molecular weight of 413.22 g/mol. Its IUPAC name is ethyl 3-bromo-2-oxopropanoate;ethyl 6-formylimidazo[1,2-a]pyridine-2-carboxylate.
| Compound Name | ethyl 3-bromo-2-oxopropanoate;ethyl 6-formylimidazo[1,2-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 159035617 |
| Molecular Formula | C16H17BrN2O6 |
| Molecular Weight | 413.22 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | ethyl 3-bromo-2-oxopropanoate;ethyl 6-formylimidazo[1,2-a]pyridine-2-carboxylate |
| SMILES | CCOC(=O)C(=O)CBr.CCOC(=O)c1cn2cc(C=O)ccc2n1 |
| InChI | InChI=1S/C11H10N2O3.C5H7BrO3/c1-2-16-11(15)9-6-13-5-8(7-14)3-4-10(13)12-9;1-2-9-5(8)4(7)3-6/h3-7H,2H2,1H3;2-3H2,1H3 |
| InChIKey | JVKQJWBSAYSMQD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 104.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|