C26H26N6O7 — CID 10929529
ethyl 6-[[(Z)-2-ethoxycarbonyl-3-[(2-ethoxycarbonylimidazo[1,2-a]pyridin-6-yl)amino]-3-oxoprop-1-enyl]amino]imidazo[1,2-a]pyridine-2-carboxylate (PubChem CID 10929529) has the molecular formula C26H26N6O7 and a molecular weight of 534.53 g/mol. Its IUPAC name is ethyl 6-[[(Z)-2-ethoxycarbonyl-3-[(2-ethoxycarbonylimidazo[1,2-a]pyridin-6-yl)amino]-3-oxoprop-1-enyl]amino]imidazo[1,2-a]pyridine-2-carboxylate.
| Compound Name | ethyl 6-[[(Z)-2-ethoxycarbonyl-3-[(2-ethoxycarbonylimidazo[1,2-a]pyridin-6-yl)amino]-3-oxoprop-1-enyl]amino]imidazo[1,2-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 10929529 |
| Molecular Formula | C26H26N6O7 |
| Molecular Weight | 534.53 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | ethyl 6-[[(Z)-2-ethoxycarbonyl-3-[(2-ethoxycarbonylimidazo[1,2-a]pyridin-6-yl)amino]-3-oxoprop-1-enyl]amino]imidazo[1,2-a]pyridine-2-carboxylate |
| SMILES | CCOC(=O)/C(=C\Nc1ccc2nc(C(=O)OCC)cn2c1)C(=O)Nc1ccc2nc(C(=O)OCC)cn2c1 |
| InChI | InChI=1S/C26H26N6O7/c1-4-37-24(34)18(11-27-16-7-9-21-29-19(14-31(21)12-16)25(35)38-5-2)23(33)28-17-8-10-22-30-20(15-32(22)13-17)26(36)39-6-3/h7-15,27H,4-6H2,1-3H3,(H,28,33)/b18-11- |
| InChIKey | SOKYILWEXQIDSV-WQRHYEAKSA-N |
| XLogP | 2.83 |
| TPSA | 154.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.53 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|