C17H22N2O5 — CID 10088244
ethyl (E)-2-[(4-methylphenyl)carbamoyl]-3-(propoxycarbonylamino)prop-2-enoate (PubChem CID 10088244) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is ethyl (E)-2-[(4-methylphenyl)carbamoyl]-3-(propoxycarbonylamino)prop-2-enoate.
| Compound Name | ethyl (E)-2-[(4-methylphenyl)carbamoyl]-3-(propoxycarbonylamino)prop-2-enoate |
|---|---|
| PubChem CID | 10088244 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | ethyl (E)-2-[(4-methylphenyl)carbamoyl]-3-(propoxycarbonylamino)prop-2-enoate |
| SMILES | CCCOC(=O)N/C=C(\C(=O)Nc1ccc(C)cc1)C(=O)OCC |
| InChI | InChI=1S/C17H22N2O5/c1-4-10-24-17(22)18-11-14(16(21)23-5-2)15(20)19-13-8-6-12(3)7-9-13/h6-9,11H,4-5,10H2,1-3H3,(H,18,22)(H,19,20)/b14-11+ |
| InChIKey | GNUBMMHHWJZQPH-SDNWHVSQSA-N |
| XLogP | 2.52 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|