C20H22N2O3 — CID 7120921
2-(ethoxymethylidene)-N,N'-bis(4-methylphenyl)propanediamide (PubChem CID 7120921) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-(ethoxymethylidene)-N,N'-bis(4-methylphenyl)propanediamide.
| Compound Name | 2-(ethoxymethylidene)-N,N'-bis(4-methylphenyl)propanediamide |
|---|---|
| PubChem CID | 7120921 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 2-(ethoxymethylidene)-N,N'-bis(4-methylphenyl)propanediamide |
| SMILES | CCOC=C(C(=O)Nc1ccc(C)cc1)C(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C20H22N2O3/c1-4-25-13-18(19(23)21-16-9-5-14(2)6-10-16)20(24)22-17-11-7-15(3)8-12-17/h5-13H,4H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | VEWVYGOADCJZSP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|