C32H44N2O2 — CID 101373282
(2Z,4Z)-N,N'-bis(4-methylphenyl)-2,3,4,5-tetrapropylhexa-2,4-dienediamide (PubChem CID 101373282) has the molecular formula C32H44N2O2 and a molecular weight of 488.72 g/mol. Its IUPAC name is (2Z,4Z)-N,N'-bis(4-methylphenyl)-2,3,4,5-tetrapropylhexa-2,4-dienediamide.
| Compound Name | (2Z,4Z)-N,N'-bis(4-methylphenyl)-2,3,4,5-tetrapropylhexa-2,4-dienediamide |
|---|---|
| PubChem CID | 101373282 |
| Molecular Formula | C32H44N2O2 |
| Molecular Weight | 488.72 g/mol |
| Exact Mass | 488.34 |
| IUPAC Name | (2Z,4Z)-N,N'-bis(4-methylphenyl)-2,3,4,5-tetrapropylhexa-2,4-dienediamide |
| SMILES | CCC/C(C(=O)Nc1ccc(C)cc1)=C(CCC)/C(CCC)=C(/CCC)C(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C32H44N2O2/c1-7-11-27(29(13-9-3)31(35)33-25-19-15-23(5)16-20-25)28(12-8-2)30(14-10-4)32(36)34-26-21-17-24(6)18-22-26/h15-22H,7-14H2,1-6H3,(H,33,35)(H,34,36)/b29-27-,30-28- |
| InChIKey | VMHJELKBQTXBSI-ZUELCTOOSA-N |
| XLogP | 8.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.72 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|