C24H21ClN2O2 — CID 7970977
2-[(2-chlorophenyl)methylidene]-N,N'-bis(4-methylphenyl)propanediamide (PubChem CID 7970977) has the molecular formula C24H21ClN2O2 and a molecular weight of 404.90 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylidene]-N,N'-bis(4-methylphenyl)propanediamide.
| Compound Name | 2-[(2-chlorophenyl)methylidene]-N,N'-bis(4-methylphenyl)propanediamide |
|---|---|
| PubChem CID | 7970977 |
| Molecular Formula | C24H21ClN2O2 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-[(2-chlorophenyl)methylidene]-N,N'-bis(4-methylphenyl)propanediamide |
| SMILES | Cc1ccc(NC(=O)C(=Cc2ccccc2Cl)C(=O)Nc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H21ClN2O2/c1-16-7-11-19(12-8-16)26-23(28)21(15-18-5-3-4-6-22(18)25)24(29)27-20-13-9-17(2)10-14-20/h3-15H,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | RQURLRIOAYHKCS-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|