C21H15ClIN3O2 — CID 87048275
(2E)-2-[(2-chloro-3-pyridinyl)methylidene]-N'-(4-iodophenyl)-N-phenylpropanediamide (PubChem CID 87048275) has the molecular formula C21H15ClIN3O2 and a molecular weight of 503.73 g/mol. Its IUPAC name is (2E)-2-[(2-chloro-3-pyridinyl)methylidene]-N'-(4-iodophenyl)-N-phenylpropanediamide.
| Compound Name | (2E)-2-[(2-chloro-3-pyridinyl)methylidene]-N'-(4-iodophenyl)-N-phenylpropanediamide |
|---|---|
| PubChem CID | 87048275 |
| Molecular Formula | C21H15ClIN3O2 |
| Molecular Weight | 503.73 g/mol |
| Exact Mass | 502.99 |
| IUPAC Name | (2E)-2-[(2-chloro-3-pyridinyl)methylidene]-N'-(4-iodophenyl)-N-phenylpropanediamide |
| SMILES | O=C(Nc1ccccc1)/C(=C\c1cccnc1Cl)C(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C21H15ClIN3O2/c22-19-14(5-4-12-24-19)13-18(20(27)25-16-6-2-1-3-7-16)21(28)26-17-10-8-15(23)9-11-17/h1-13H,(H,25,27)(H,26,28)/b18-13+ |
| InChIKey | XGZWNPYZALPWBW-QGOAFFKASA-N |
| XLogP | 5.00 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.73 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|