C22H17Cl2N3O3 — CID 91969910
N'-(2-chloro-4-methoxyphenyl)-2-[(2-chloro-3-pyridinyl)methylidene]-N-phenylpropanediamide (PubChem CID 91969910) has the molecular formula C22H17Cl2N3O3 and a molecular weight of 442.30 g/mol. Its IUPAC name is N'-(2-chloro-4-methoxyphenyl)-2-[(2-chloro-3-pyridinyl)methylidene]-N-phenylpropanediamide.
| Compound Name | N'-(2-chloro-4-methoxyphenyl)-2-[(2-chloro-3-pyridinyl)methylidene]-N-phenylpropanediamide |
|---|---|
| PubChem CID | 91969910 |
| Molecular Formula | C22H17Cl2N3O3 |
| Molecular Weight | 442.30 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | N'-(2-chloro-4-methoxyphenyl)-2-[(2-chloro-3-pyridinyl)methylidene]-N-phenylpropanediamide |
| SMILES | COc1ccc(NC(=O)C(=Cc2cccnc2Cl)C(=O)Nc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C22H17Cl2N3O3/c1-30-16-9-10-19(18(23)13-16)27-22(29)17(12-14-6-5-11-25-20(14)24)21(28)26-15-7-3-2-4-8-15/h2-13H,1H3,(H,26,28)(H,27,29) |
| InChIKey | RQMSIWSWEICJRO-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.30 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|