C22H17BrClN3O2 — CID 87048280
(2E)-N'-(2-bromo-5-methylphenyl)-2-[(2-chloro-3-pyridinyl)methylidene]-N-phenylpropanediamide (PubChem CID 87048280) has the molecular formula C22H17BrClN3O2 and a molecular weight of 470.75 g/mol. Its IUPAC name is (2E)-N'-(2-bromo-5-methylphenyl)-2-[(2-chloro-3-pyridinyl)methylidene]-N-phenylpropanediamide.
| Compound Name | (2E)-N'-(2-bromo-5-methylphenyl)-2-[(2-chloro-3-pyridinyl)methylidene]-N-phenylpropanediamide |
|---|---|
| PubChem CID | 87048280 |
| Molecular Formula | C22H17BrClN3O2 |
| Molecular Weight | 470.75 g/mol |
| Exact Mass | 469.02 |
| IUPAC Name | (2E)-N'-(2-bromo-5-methylphenyl)-2-[(2-chloro-3-pyridinyl)methylidene]-N-phenylpropanediamide |
| SMILES | Cc1ccc(Br)c(NC(=O)/C(=C/c2cccnc2Cl)C(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C22H17BrClN3O2/c1-14-9-10-18(23)19(12-14)27-22(29)17(13-15-6-5-11-25-20(15)24)21(28)26-16-7-3-2-4-8-16/h2-13H,1H3,(H,26,28)(H,27,29)/b17-13+ |
| InChIKey | MQHKQAYRGKGHIG-GHRIWEEISA-N |
| XLogP | 5.47 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.75 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|