C25H23ClN4O2 — CID 87048288
(E)-3-(2-chloro-3-pyridinyl)-N-phenyl-2-(4-phenylpiperazine-1-carbonyl)prop-2-enamide (PubChem CID 87048288) has the molecular formula C25H23ClN4O2 and a molecular weight of 446.94 g/mol. Its IUPAC name is (E)-3-(2-chloro-3-pyridinyl)-N-phenyl-2-(4-phenylpiperazine-1-carbonyl)prop-2-enamide.
| Compound Name | (E)-3-(2-chloro-3-pyridinyl)-N-phenyl-2-(4-phenylpiperazine-1-carbonyl)prop-2-enamide |
|---|---|
| PubChem CID | 87048288 |
| Molecular Formula | C25H23ClN4O2 |
| Molecular Weight | 446.94 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | (E)-3-(2-chloro-3-pyridinyl)-N-phenyl-2-(4-phenylpiperazine-1-carbonyl)prop-2-enamide |
| SMILES | O=C(Nc1ccccc1)/C(=C\c1cccnc1Cl)C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H23ClN4O2/c26-23-19(8-7-13-27-23)18-22(24(31)28-20-9-3-1-4-10-20)25(32)30-16-14-29(15-17-30)21-11-5-2-6-12-21/h1-13,18H,14-17H2,(H,28,31)/b22-18+ |
| InChIKey | MKVLYRMBODFJJT-RELWKKBWSA-N |
| XLogP | 4.11 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.94 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|