C13H11ClN4O2 — CID 108520500
N-(2-chloro-3-pyridinyl)-N'-(4-methyl-2-pyridinyl)oxamide (PubChem CID 108520500) has the molecular formula C13H11ClN4O2 and a molecular weight of 290.71 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-N'-(4-methyl-2-pyridinyl)oxamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-N'-(4-methyl-2-pyridinyl)oxamide |
|---|---|
| PubChem CID | 108520500 |
| Molecular Formula | C13H11ClN4O2 |
| Molecular Weight | 290.71 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-N'-(4-methyl-2-pyridinyl)oxamide |
| SMILES | Cc1ccnc(NC(=O)C(=O)Nc2cccnc2Cl)c1 |
| InChI | InChI=1S/C13H11ClN4O2/c1-8-4-6-15-10(7-8)18-13(20)12(19)17-9-3-2-5-16-11(9)14/h2-7H,1H3,(H,17,19)(H,15,18,20) |
| InChIKey | GPTPIMKHEJAMOV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.71 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|