C15H15N3O2 — CID 45000004
N-(2-methylphenyl)-N'-(4-methyl-2-pyridinyl)oxamide (PubChem CID 45000004) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is N-(2-methylphenyl)-N'-(4-methyl-2-pyridinyl)oxamide.
| Compound Name | N-(2-methylphenyl)-N'-(4-methyl-2-pyridinyl)oxamide |
|---|---|
| PubChem CID | 45000004 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-(2-methylphenyl)-N'-(4-methyl-2-pyridinyl)oxamide |
| SMILES | Cc1ccnc(NC(=O)C(=O)Nc2ccccc2C)c1 |
| InChI | InChI=1S/C15H15N3O2/c1-10-7-8-16-13(9-10)18-15(20)14(19)17-12-6-4-3-5-11(12)2/h3-9H,1-2H3,(H,17,19)(H,16,18,20) |
| InChIKey | LJMMNRSDQNLUEL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|