C22H17NO2 — CID 9448914
(E)-2-benzoyl-N,3-diphenylprop-2-enamide (PubChem CID 9448914) has the molecular formula C22H17NO2 and a molecular weight of 327.38 g/mol. Its IUPAC name is (E)-2-benzoyl-N,3-diphenylprop-2-enamide.
| Compound Name | (E)-2-benzoyl-N,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 9448914 |
| Molecular Formula | C22H17NO2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (E)-2-benzoyl-N,3-diphenylprop-2-enamide |
| SMILES | O=C(Nc1ccccc1)/C(=C/c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H17NO2/c24-21(18-12-6-2-7-13-18)20(16-17-10-4-1-5-11-17)22(25)23-19-14-8-3-9-15-19/h1-16H,(H,23,25)/b20-16+ |
| InChIKey | VTUAEIISLPSRJO-CAPFRKAQSA-N |
| XLogP | 4.59 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|