C24H21NO5 — CID 9448911
(E)-2-benzoyl-3-(3-hydroxy-4-methoxyphenyl)-N-(3-methoxyphenyl)prop-2-enamide (PubChem CID 9448911) has the molecular formula C24H21NO5 and a molecular weight of 403.43 g/mol. Its IUPAC name is (E)-2-benzoyl-3-(3-hydroxy-4-methoxyphenyl)-N-(3-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-benzoyl-3-(3-hydroxy-4-methoxyphenyl)-N-(3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 9448911 |
| Molecular Formula | C24H21NO5 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | (E)-2-benzoyl-3-(3-hydroxy-4-methoxyphenyl)-N-(3-methoxyphenyl)prop-2-enamide |
| SMILES | COc1cccc(NC(=O)/C(=C/c2ccc(OC)c(O)c2)C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H21NO5/c1-29-19-10-6-9-18(15-19)25-24(28)20(23(27)17-7-4-3-5-8-17)13-16-11-12-22(30-2)21(26)14-16/h3-15,26H,1-2H3,(H,25,28)/b20-13+ |
| InChIKey | BFFDIAXYUJXPQB-DEDYPNTBSA-N |
| XLogP | 4.31 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|