C24H22N2O4 — CID 9042004
(E)-3-(4-hydroxy-3,5-dimethylphenyl)-N-(3-methoxyphenyl)-2-(pyridine-3-carbonyl)prop-2-enamide (PubChem CID 9042004) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is (E)-3-(4-hydroxy-3,5-dimethylphenyl)-N-(3-methoxyphenyl)-2-(pyridine-3-carbonyl)prop-2-enamide.
| Compound Name | (E)-3-(4-hydroxy-3,5-dimethylphenyl)-N-(3-methoxyphenyl)-2-(pyridine-3-carbonyl)prop-2-enamide |
|---|---|
| PubChem CID | 9042004 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | (E)-3-(4-hydroxy-3,5-dimethylphenyl)-N-(3-methoxyphenyl)-2-(pyridine-3-carbonyl)prop-2-enamide |
| SMILES | COc1cccc(NC(=O)/C(=C/c2cc(C)c(O)c(C)c2)C(=O)c2cccnc2)c1 |
| InChI | InChI=1S/C24H22N2O4/c1-15-10-17(11-16(2)22(15)27)12-21(23(28)18-6-5-9-25-14-18)24(29)26-19-7-4-8-20(13-19)30-3/h4-14,27H,1-3H3,(H,26,29)/b21-12+ |
| InChIKey | LSNRRECKNSHUSL-CIAFOILYSA-N |
| XLogP | 4.32 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|