C20H15ClN2O2S — CID 51111967
2-[(5-chlorothiophen-2-yl)methylidene]-N,N'-diphenylpropanediamide (PubChem CID 51111967) has the molecular formula C20H15ClN2O2S and a molecular weight of 382.87 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)methylidene]-N,N'-diphenylpropanediamide.
| Compound Name | 2-[(5-chlorothiophen-2-yl)methylidene]-N,N'-diphenylpropanediamide |
|---|---|
| PubChem CID | 51111967 |
| Molecular Formula | C20H15ClN2O2S |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)methylidene]-N,N'-diphenylpropanediamide |
| SMILES | O=C(Nc1ccccc1)C(=Cc1ccc(Cl)s1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H15ClN2O2S/c21-18-12-11-16(26-18)13-17(19(24)22-14-7-3-1-4-8-14)20(25)23-15-9-5-2-6-10-15/h1-13H,(H,22,24)(H,23,25) |
| InChIKey | BWAUHNJIYXYCQZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|