C17H12Cl3NO2 — CID 18530945
(2Z)-4-chloro-2-[(3,4-dichlorophenyl)methylidene]-3-oxo-N-phenylbutanamide (PubChem CID 18530945) has the molecular formula C17H12Cl3NO2 and a molecular weight of 368.65 g/mol. Its IUPAC name is (2Z)-4-chloro-2-[(3,4-dichlorophenyl)methylidene]-3-oxo-N-phenylbutanamide.
| Compound Name | (2Z)-4-chloro-2-[(3,4-dichlorophenyl)methylidene]-3-oxo-N-phenylbutanamide |
|---|---|
| PubChem CID | 18530945 |
| Molecular Formula | C17H12Cl3NO2 |
| Molecular Weight | 368.65 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | (2Z)-4-chloro-2-[(3,4-dichlorophenyl)methylidene]-3-oxo-N-phenylbutanamide |
| SMILES | O=C(CCl)/C(=C/c1ccc(Cl)c(Cl)c1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H12Cl3NO2/c18-10-16(22)13(8-11-6-7-14(19)15(20)9-11)17(23)21-12-4-2-1-3-5-12/h1-9H,10H2,(H,21,23)/b13-8- |
| InChIKey | SGFPJHRFHDTLRS-JYRVWZFOSA-N |
| XLogP | 4.82 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.65 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|