C20H19Cl2NO2 — CID 86586027
2-[(3,4-dichlorophenyl)methylidene]-3-oxo-N-(3-phenylpropyl)butanamide (PubChem CID 86586027) has the molecular formula C20H19Cl2NO2 and a molecular weight of 376.28 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylidene]-3-oxo-N-(3-phenylpropyl)butanamide.
| Compound Name | 2-[(3,4-dichlorophenyl)methylidene]-3-oxo-N-(3-phenylpropyl)butanamide |
|---|---|
| PubChem CID | 86586027 |
| Molecular Formula | C20H19Cl2NO2 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methylidene]-3-oxo-N-(3-phenylpropyl)butanamide |
| SMILES | CC(=O)C(=Cc1ccc(Cl)c(Cl)c1)C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C20H19Cl2NO2/c1-14(24)17(12-16-9-10-18(21)19(22)13-16)20(25)23-11-5-8-15-6-3-2-4-7-15/h2-4,6-7,9-10,12-13H,5,8,11H2,1H3,(H,23,25) |
| InChIKey | PHWVOYXIMBQFGX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|