C11H11Cl2NO2 — CID 110478308
N-[2-(3,4-dichlorophenyl)ethyl]-2-oxopropanamide (PubChem CID 110478308) has the molecular formula C11H11Cl2NO2 and a molecular weight of 260.12 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)ethyl]-2-oxopropanamide.
| Compound Name | N-[2-(3,4-dichlorophenyl)ethyl]-2-oxopropanamide |
|---|---|
| PubChem CID | 110478308 |
| Molecular Formula | C11H11Cl2NO2 |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)ethyl]-2-oxopropanamide |
| SMILES | CC(=O)C(=O)NCCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H11Cl2NO2/c1-7(15)11(16)14-5-4-8-2-3-9(12)10(13)6-8/h2-3,6H,4-5H2,1H3,(H,14,16) |
| InChIKey | PMYVKORSMBSELQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|