C26H26N2O4 — CID 2377632
2-[(3,4-dihydroxyphenyl)methylidene]-N,N'-bis(2-phenylethyl)propanediamide (PubChem CID 2377632) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is 2-[(3,4-dihydroxyphenyl)methylidene]-N,N'-bis(2-phenylethyl)propanediamide.
| Compound Name | 2-[(3,4-dihydroxyphenyl)methylidene]-N,N'-bis(2-phenylethyl)propanediamide |
|---|---|
| PubChem CID | 2377632 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 2-[(3,4-dihydroxyphenyl)methylidene]-N,N'-bis(2-phenylethyl)propanediamide |
| SMILES | O=C(NCCc1ccccc1)C(=Cc1ccc(O)c(O)c1)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C26H26N2O4/c29-23-12-11-21(18-24(23)30)17-22(25(31)27-15-13-19-7-3-1-4-8-19)26(32)28-16-14-20-9-5-2-6-10-20/h1-12,17-18,29-30H,13-16H2,(H,27,31)(H,28,32) |
| InChIKey | PMOMCRXHLMXDIY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|