C29H26N2O2 — CID 126604873
(Z)-2-hydroxy-3-[4-(N-phenylanilino)phenyl]-N-(2-phenylethyl)prop-2-enamide (PubChem CID 126604873) has the molecular formula C29H26N2O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is (Z)-2-hydroxy-3-[4-(N-phenylanilino)phenyl]-N-(2-phenylethyl)prop-2-enamide.
| Compound Name | (Z)-2-hydroxy-3-[4-(N-phenylanilino)phenyl]-N-(2-phenylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 126604873 |
| Molecular Formula | C29H26N2O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | (Z)-2-hydroxy-3-[4-(N-phenylanilino)phenyl]-N-(2-phenylethyl)prop-2-enamide |
| SMILES | O=C(NCCc1ccccc1)/C(O)=C/c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H26N2O2/c32-28(29(33)30-21-20-23-10-4-1-5-11-23)22-24-16-18-27(19-17-24)31(25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-19,22,32H,20-21H2,(H,30,33)/b28-22- |
| InChIKey | IUVFJMLVFIKEJC-SLMZUGIISA-N |
| XLogP | 6.41 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|