C30H28N2O — CID 71017879
(Z)-2-methyl-3-[4-(N-phenylanilino)phenyl]-N-(2-phenylethyl)prop-2-enamide (PubChem CID 71017879) has the molecular formula C30H28N2O and a molecular weight of 432.57 g/mol. Its IUPAC name is (Z)-2-methyl-3-[4-(N-phenylanilino)phenyl]-N-(2-phenylethyl)prop-2-enamide.
| Compound Name | (Z)-2-methyl-3-[4-(N-phenylanilino)phenyl]-N-(2-phenylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 71017879 |
| Molecular Formula | C30H28N2O |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | (Z)-2-methyl-3-[4-(N-phenylanilino)phenyl]-N-(2-phenylethyl)prop-2-enamide |
| SMILES | C/C(=C/c1ccc(N(c2ccccc2)c2ccccc2)cc1)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C30H28N2O/c1-24(30(33)31-22-21-25-11-5-2-6-12-25)23-26-17-19-29(20-18-26)32(27-13-7-3-8-14-27)28-15-9-4-10-16-28/h2-20,23H,21-22H2,1H3,(H,31,33)/b24-23- |
| InChIKey | KFWHLRRQJRSOMO-VHXPQNKSSA-N |
| XLogP | 6.92 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|