C31H34N2O6 — CID 54582857
(2E)-2-[(3,4-dihydroxyphenyl)methylidene]-N-[(2S)-4-[2-(4-methoxyphenyl)ethylamino]-3,4-dioxo-1-phenylbutan-2-yl]pentanamide (PubChem CID 54582857) has the molecular formula C31H34N2O6 and a molecular weight of 530.62 g/mol. Its IUPAC name is (2E)-2-[(3,4-dihydroxyphenyl)methylidene]-N-[(2S)-4-[2-(4-methoxyphenyl)ethylamino]-3,4-dioxo-1-phenylbutan-2-yl]pentanamide.
| Compound Name | (2E)-2-[(3,4-dihydroxyphenyl)methylidene]-N-[(2S)-4-[2-(4-methoxyphenyl)ethylamino]-3,4-dioxo-1-phenylbutan-2-yl]pentanamide |
|---|---|
| PubChem CID | 54582857 |
| Molecular Formula | C31H34N2O6 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | (2E)-2-[(3,4-dihydroxyphenyl)methylidene]-N-[(2S)-4-[2-(4-methoxyphenyl)ethylamino]-3,4-dioxo-1-phenylbutan-2-yl]pentanamide |
| SMILES | CCC/C(=C\c1ccc(O)c(O)c1)C(=O)N[C@@H](Cc1ccccc1)C(=O)C(=O)NCCc1ccc(OC)cc1 |
| InChI | InChI=1S/C31H34N2O6/c1-3-7-24(18-23-12-15-27(34)28(35)20-23)30(37)33-26(19-22-8-5-4-6-9-22)29(36)31(38)32-17-16-21-10-13-25(39-2)14-11-21/h4-6,8-15,18,20,26,34-35H,3,7,16-17,19H2,1-2H3,(H,32,38)(H,33,37)/b24-18+/t26-/m0/s1 |
| InChIKey | IACGNQPIQKFPAO-INZJWMLVSA-N |
| XLogP | 3.95 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|