C33H38N2O6 — CID 59856323
ethyl 4-[4-[(2S)-3-[2-(4-methoxyphenyl)ethylamino]-3-oxo-2-[[(E)-3-phenylprop-2-enoyl]amino]propyl]phenoxy]butanoate (PubChem CID 59856323) has the molecular formula C33H38N2O6 and a molecular weight of 558.68 g/mol. Its IUPAC name is ethyl 4-[4-[(2S)-3-[2-(4-methoxyphenyl)ethylamino]-3-oxo-2-[[(E)-3-phenylprop-2-enoyl]amino]propyl]phenoxy]butanoate.
| Compound Name | ethyl 4-[4-[(2S)-3-[2-(4-methoxyphenyl)ethylamino]-3-oxo-2-[[(E)-3-phenylprop-2-enoyl]amino]propyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 59856323 |
| Molecular Formula | C33H38N2O6 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | ethyl 4-[4-[(2S)-3-[2-(4-methoxyphenyl)ethylamino]-3-oxo-2-[[(E)-3-phenylprop-2-enoyl]amino]propyl]phenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1ccc(C[C@H](NC(=O)/C=C/c2ccccc2)C(=O)NCCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C33H38N2O6/c1-3-40-32(37)10-7-23-41-29-18-13-27(14-19-29)24-30(35-31(36)20-15-25-8-5-4-6-9-25)33(38)34-22-21-26-11-16-28(39-2)17-12-26/h4-6,8-9,11-20,30H,3,7,10,21-24H2,1-2H3,(H,34,38)(H,35,36)/b20-15+/t30-/m0/s1 |
| InChIKey | SNVALPUTMHHZNI-SFZRXAIMSA-N |
| XLogP | 4.52 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|