C22H25NO5 — CID 70423548
(2S)-3-[4-(2-methoxyethoxy)phenyl]-2-[[(E)-3-(4-methylphenyl)prop-2-enoyl]amino]propanoic acid (PubChem CID 70423548) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is (2S)-3-[4-(2-methoxyethoxy)phenyl]-2-[[(E)-3-(4-methylphenyl)prop-2-enoyl]amino]propanoic acid.
| Compound Name | (2S)-3-[4-(2-methoxyethoxy)phenyl]-2-[[(E)-3-(4-methylphenyl)prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 70423548 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (2S)-3-[4-(2-methoxyethoxy)phenyl]-2-[[(E)-3-(4-methylphenyl)prop-2-enoyl]amino]propanoic acid |
| SMILES | COCCOc1ccc(C[C@H](NC(=O)/C=C/c2ccc(C)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C22H25NO5/c1-16-3-5-17(6-4-16)9-12-21(24)23-20(22(25)26)15-18-7-10-19(11-8-18)28-14-13-27-2/h3-12,20H,13-15H2,1-2H3,(H,23,24)(H,25,26)/b12-9+/t20-/m0/s1 |
| InChIKey | HSMLHMNDWKPTDE-JTPHSUOKSA-N |
| XLogP | 2.85 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|