C13H15NO5 — CID 61153484
(2S)-3-hydroxy-2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoic acid (PubChem CID 61153484) has the molecular formula C13H15NO5 and a molecular weight of 265.27 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoic acid.
| Compound Name | (2S)-3-hydroxy-2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoic acid |
|---|---|
| PubChem CID | 61153484 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | (2S)-3-hydroxy-2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoic acid |
| SMILES | COc1ccc(C=CC(=O)N[C@@H](CO)C(=O)O)cc1 |
| InChI | InChI=1S/C13H15NO5/c1-19-10-5-2-9(3-6-10)4-7-12(16)14-11(8-15)13(17)18/h2-7,11,15H,8H2,1H3,(H,14,16)(H,17,18)/t11-/m0/s1 |
| InChIKey | PIIXDDHTNNBSAI-NSHDSACASA-N |
| XLogP | 0.27 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|