C13H14ClNO4 — CID 43357562
2-[[(E)-3-(3-chloro-4-methylphenyl)prop-2-enoyl]amino]-3-hydroxypropanoic acid (PubChem CID 43357562) has the molecular formula C13H14ClNO4 and a molecular weight of 283.71 g/mol. Its IUPAC name is 2-[[(E)-3-(3-chloro-4-methylphenyl)prop-2-enoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[(E)-3-(3-chloro-4-methylphenyl)prop-2-enoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 43357562 |
| Molecular Formula | C13H14ClNO4 |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 2-[[(E)-3-(3-chloro-4-methylphenyl)prop-2-enoyl]amino]-3-hydroxypropanoic acid |
| SMILES | Cc1ccc(/C=C/C(=O)NC(CO)C(=O)O)cc1Cl |
| InChI | InChI=1S/C13H14ClNO4/c1-8-2-3-9(6-10(8)14)4-5-12(17)15-11(7-16)13(18)19/h2-6,11,16H,7H2,1H3,(H,15,17)(H,18,19)/b5-4+ |
| InChIKey | AJJMREWIATYWAS-SNAWJCMRSA-N |
| XLogP | 1.22 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|