C15H18ClNO3 — CID 107562743
(2R)-2-[[(E)-3-(3-chloro-4-methylphenyl)prop-2-enoyl]amino]pentanoic acid (PubChem CID 107562743) has the molecular formula C15H18ClNO3 and a molecular weight of 295.77 g/mol. Its IUPAC name is (2R)-2-[[(E)-3-(3-chloro-4-methylphenyl)prop-2-enoyl]amino]pentanoic acid.
| Compound Name | (2R)-2-[[(E)-3-(3-chloro-4-methylphenyl)prop-2-enoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 107562743 |
| Molecular Formula | C15H18ClNO3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | (2R)-2-[[(E)-3-(3-chloro-4-methylphenyl)prop-2-enoyl]amino]pentanoic acid |
| SMILES | CCC[C@@H](NC(=O)/C=C/c1ccc(C)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C15H18ClNO3/c1-3-4-13(15(19)20)17-14(18)8-7-11-6-5-10(2)12(16)9-11/h5-9,13H,3-4H2,1-2H3,(H,17,18)(H,19,20)/b8-7+/t13-/m1/s1 |
| InChIKey | XUTZWWYJSFHODK-SBDDDAINSA-N |
| XLogP | 3.03 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|