C16H20ClNO3 — CID 82845513
5-[[(E)-3-(3-chloro-4-methylphenyl)prop-2-enoyl]amino]hexanoic acid (PubChem CID 82845513) has the molecular formula C16H20ClNO3 and a molecular weight of 309.79 g/mol. Its IUPAC name is 5-[[(E)-3-(3-chloro-4-methylphenyl)prop-2-enoyl]amino]hexanoic acid.
| Compound Name | 5-[[(E)-3-(3-chloro-4-methylphenyl)prop-2-enoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 82845513 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 5-[[(E)-3-(3-chloro-4-methylphenyl)prop-2-enoyl]amino]hexanoic acid |
| SMILES | Cc1ccc(/C=C/C(=O)NC(C)CCCC(=O)O)cc1Cl |
| InChI | InChI=1S/C16H20ClNO3/c1-11-6-7-13(10-14(11)17)8-9-15(19)18-12(2)4-3-5-16(20)21/h6-10,12H,3-5H2,1-2H3,(H,18,19)(H,20,21)/b9-8+ |
| InChIKey | JTWVFWSCQUABCR-CMDGGOBGSA-N |
| XLogP | 3.42 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|