C13H13Cl2NO4 — CID 43407087
methyl 2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-3-hydroxypropanoate (PubChem CID 43407087) has the molecular formula C13H13Cl2NO4 and a molecular weight of 318.16 g/mol. Its IUPAC name is methyl 2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-3-hydroxypropanoate.
| Compound Name | methyl 2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 43407087 |
| Molecular Formula | C13H13Cl2NO4 |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | methyl 2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-3-hydroxypropanoate |
| SMILES | COC(=O)C(CO)NC(=O)/C=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H13Cl2NO4/c1-20-13(19)11(7-17)16-12(18)5-3-8-2-4-9(14)10(15)6-8/h2-6,11,17H,7H2,1H3,(H,16,18)/b5-3+ |
| InChIKey | PRFIZMAQXSQKJB-HWKANZROSA-N |
| XLogP | 1.66 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|