C21H26Cl2N2O6 — CID 90960988
(2S)-2-[3-(3,4-dichlorophenyl)prop-2-enoylamino]-3-hydroxy-N-[(2S)-1-[(2R)-2-(hydroxymethyl)oxiran-2-yl]-4-methyl-1-oxopentan-2-yl]propanamide (PubChem CID 90960988) has the molecular formula C21H26Cl2N2O6 and a molecular weight of 473.35 g/mol. Its IUPAC name is (2S)-2-[3-(3,4-dichlorophenyl)prop-2-enoylamino]-3-hydroxy-N-[(2S)-1-[(2R)-2-(hydroxymethyl)oxiran-2-yl]-4-methyl-1-oxopentan-2-yl]propanamide.
| Compound Name | (2S)-2-[3-(3,4-dichlorophenyl)prop-2-enoylamino]-3-hydroxy-N-[(2S)-1-[(2R)-2-(hydroxymethyl)oxiran-2-yl]-4-methyl-1-oxopentan-2-yl]propanamide |
|---|---|
| PubChem CID | 90960988 |
| Molecular Formula | C21H26Cl2N2O6 |
| Molecular Weight | 473.35 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | (2S)-2-[3-(3,4-dichlorophenyl)prop-2-enoylamino]-3-hydroxy-N-[(2S)-1-[(2R)-2-(hydroxymethyl)oxiran-2-yl]-4-methyl-1-oxopentan-2-yl]propanamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CO)NC(=O)C=Cc1ccc(Cl)c(Cl)c1)C(=O)[C@@]1(CO)CO1 |
| InChI | InChI=1S/C21H26Cl2N2O6/c1-12(2)7-16(19(29)21(10-27)11-31-21)25-20(30)17(9-26)24-18(28)6-4-13-3-5-14(22)15(23)8-13/h3-6,8,12,16-17,26-27H,7,9-11H2,1-2H3,(H,24,28)(H,25,30)/t16-,17-,21+/m0/s1 |
| InChIKey | UMDXVOMQMYZFNJ-XGHQBKJUSA-N |
| XLogP | 1.35 |
| TPSA | 128.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|