C31H35N2O7P — CID 76574022
4-diphenylphosphoryl-N-[3-hydroxy-1-[[1-[2-(hydroxymethyl)oxiran-2-yl]-4-methyl-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]benzamide (PubChem CID 76574022) has the molecular formula C31H35N2O7P and a molecular weight of 578.60 g/mol. Its IUPAC name is 4-diphenylphosphoryl-N-[3-hydroxy-1-[[1-[2-(hydroxymethyl)oxiran-2-yl]-4-methyl-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]benzamide.
| Compound Name | 4-diphenylphosphoryl-N-[3-hydroxy-1-[[1-[2-(hydroxymethyl)oxiran-2-yl]-4-methyl-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 76574022 |
| Molecular Formula | C31H35N2O7P |
| Molecular Weight | 578.60 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | 4-diphenylphosphoryl-N-[3-hydroxy-1-[[1-[2-(hydroxymethyl)oxiran-2-yl]-4-methyl-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]benzamide |
| SMILES | CC(C)CC(NC(=O)C(CO)NC(=O)c1ccc(P(=O)(c2ccccc2)c2ccccc2)cc1)C(=O)C1(CO)CO1 |
| InChI | InChI=1S/C31H35N2O7P/c1-21(2)17-26(28(36)31(19-35)20-40-31)32-30(38)27(18-34)33-29(37)22-13-15-25(16-14-22)41(39,23-9-5-3-6-10-23)24-11-7-4-8-12-24/h3-16,21,26-27,34-35H,17-20H2,1-2H3,(H,32,38)(H,33,37) |
| InChIKey | XLMUGHPUBYHRRJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 145.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.60 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|