C24H28N2O5 — CID 142265135
N-[2-[[1-[2-(hydroxymethyl)oxiran-2-yl]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]-3-phenylbenzamide (PubChem CID 142265135) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is N-[2-[[1-[2-(hydroxymethyl)oxiran-2-yl]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]-3-phenylbenzamide.
| Compound Name | N-[2-[[1-[2-(hydroxymethyl)oxiran-2-yl]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]-3-phenylbenzamide |
|---|---|
| PubChem CID | 142265135 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | N-[2-[[1-[2-(hydroxymethyl)oxiran-2-yl]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]-3-phenylbenzamide |
| SMILES | CC(C)CC(NC(=O)CNC(=O)c1cccc(-c2ccccc2)c1)C(=O)C1(CO)CO1 |
| InChI | InChI=1S/C24H28N2O5/c1-16(2)11-20(22(29)24(14-27)15-31-24)26-21(28)13-25-23(30)19-10-6-9-18(12-19)17-7-4-3-5-8-17/h3-10,12,16,20,27H,11,13-15H2,1-2H3,(H,25,30)(H,26,28) |
| InChIKey | VXWWHGJECZYAOS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 108.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|