C13H24N2O4 — CID 142265147
3-amino-N-[1-[2-(hydroxymethyl)oxiran-2-yl]-4-methyl-1-oxopentan-2-yl]-2-methylpropanamide (PubChem CID 142265147) has the molecular formula C13H24N2O4 and a molecular weight of 272.35 g/mol. Its IUPAC name is 3-amino-N-[1-[2-(hydroxymethyl)oxiran-2-yl]-4-methyl-1-oxopentan-2-yl]-2-methylpropanamide.
| Compound Name | 3-amino-N-[1-[2-(hydroxymethyl)oxiran-2-yl]-4-methyl-1-oxopentan-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 142265147 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 3-amino-N-[1-[2-(hydroxymethyl)oxiran-2-yl]-4-methyl-1-oxopentan-2-yl]-2-methylpropanamide |
| SMILES | CC(C)CC(NC(=O)C(C)CN)C(=O)C1(CO)CO1 |
| InChI | InChI=1S/C13H24N2O4/c1-8(2)4-10(15-12(18)9(3)5-14)11(17)13(6-16)7-19-13/h8-10,16H,4-7,14H2,1-3H3,(H,15,18) |
| InChIKey | HMSXUBKKRAHEJX-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|