C17H19N3O4 — CID 9085094
methyl (2R)-2-[[(E)-3-(1-benzylpyrazol-4-yl)prop-2-enoyl]amino]-3-hydroxypropanoate (PubChem CID 9085094) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is methyl (2R)-2-[[(E)-3-(1-benzylpyrazol-4-yl)prop-2-enoyl]amino]-3-hydroxypropanoate.
| Compound Name | methyl (2R)-2-[[(E)-3-(1-benzylpyrazol-4-yl)prop-2-enoyl]amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 9085094 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | methyl (2R)-2-[[(E)-3-(1-benzylpyrazol-4-yl)prop-2-enoyl]amino]-3-hydroxypropanoate |
| SMILES | COC(=O)[C@@H](CO)NC(=O)/C=C/c1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C17H19N3O4/c1-24-17(23)15(12-21)19-16(22)8-7-14-9-18-20(11-14)10-13-5-3-2-4-6-13/h2-9,11,15,21H,10,12H2,1H3,(H,19,22)/b8-7+/t15-/m1/s1 |
| InChIKey | HFFAASPIRZUADW-MVGZEHJDSA-N |
| XLogP | 0.59 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|